cas: 1554367-11-1 — see every product listed under this CAS number, including other names
3-(1,2,2,2-Tetrafluoroethyl)aniline, ≥95%, ≥95% (CAS 1554367-11-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DF74-100mg |
| cas | 1554367-11-1 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1235.60 Pln | |
| Chemat | 250mg | 1442.00 Pln | |
| Chemat | 5g | 9021.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
3-(1,2,2,2-tetrafluoroethyl)aniline (CAS 1554367-11-1) is a chemical compound with the molecular formula C8H7F4N and a molecular weight of 193.14 g/mol. IUPAC name: 3-(1,2,2,2-tetrafluoroethyl)aniline. InChIKey: IXBYFFSOEJUOIK-UHFFFAOYSA-N.
| Molecular formula | C8H7F4N |
|---|---|
| Molecular weight | 193.14 g/mol |
| IUPAC name | 3-(1,2,2,2-tetrafluoroethyl)aniline |
| InChIKey | IXBYFFSOEJUOIK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C(C(F)(F)F)F |
Computed by PubChem (NCBI)