cas: 1269087-62-8 — see every product listed under this CAS number, including other names
3-(1,3,5-trimethyl-1H-pyrazol-4-yl)propanoic acid hydrochloride, 98% (CAS 1269087-62-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F358756-1G |
| cas | 1269087-62-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 320.74 Pln | |
| Fluorochem | 5g | 690.40 Pln | |
| Fluorochem | 10g | 893.45 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-(1,3,5-trimethylpyrazol-4-yl)propanoic acid;hydrochloride (CAS 1269087-62-8) is a chemical compound with the molecular formula C9H15ClN2O2 and a molecular weight of 218.68 g/mol. IUPAC name: 3-(1,3,5-trimethylpyrazol-4-yl)propanoic acid;hydrochloride. InChIKey: AWHFHCCPTUJTMO-UHFFFAOYSA-N.
| Molecular formula | C9H15ClN2O2 |
|---|---|
| Molecular weight | 218.68 g/mol |
| IUPAC name | 3-(1,3,5-trimethylpyrazol-4-yl)propanoic acid;hydrochloride |
| InChIKey | AWHFHCCPTUJTMO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C)C)CCC(=O)O.Cl |
Computed by PubChem (NCBI)