cas: 2096341-54-5 — see every product listed under this CAS number, including other names
3-(1-Cyanocyclopropyl)-2-fluorophenylboronic acid, 97%, 97% (CAS 2096341-54-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EHB5-250mg |
| cas | 2096341-54-5 |
| size | 250mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 266.00 Pln | |
| Chemat | 1g | 611.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[3-(1-cyanocyclopropyl)-2-fluorophenyl]boronic acid (CAS 2096341-54-5) is a chemical compound with the molecular formula C10H9BFNO2 and a molecular weight of 205.00 g/mol. IUPAC name: [3-(1-cyanocyclopropyl)-2-fluorophenyl]boronic acid. InChIKey: BRQZJOXEWXYOFH-UHFFFAOYSA-N.
| Molecular formula | C10H9BFNO2 |
|---|---|
| Molecular weight | 205.00 g/mol |
| IUPAC name | [3-(1-cyanocyclopropyl)-2-fluorophenyl]boronic acid |
| InChIKey | BRQZJOXEWXYOFH-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)C2(CC2)C#N)F)(O)O |
Computed by PubChem (NCBI)