CAS 957035-06-2 appears in our catalog under these names: 8-Fluoro-2-methylquinoline-7-boronic acid, 97%, (8-Fluoro-2-methylquinolin-7-yl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g, 100mg.
(8-fluoro-2-methylquinolin-7-yl)boronic acid (CAS 957035-06-2) is a chemical compound with the molecular formula C10H9BFNO2 and a molecular weight of 205.00 g/mol. IUPAC name: (8-fluoro-2-methylquinolin-7-yl)boronic acid. InChIKey: BVJIKMGAYNZCCJ-UHFFFAOYSA-N.
| Molecular formula | C10H9BFNO2 |
|---|---|
| Molecular weight | 205.00 g/mol |
| IUPAC name | (8-fluoro-2-methylquinolin-7-yl)boronic acid |
| InChIKey | BVJIKMGAYNZCCJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C2=C(C=C1)C=CC(=N2)C)F)(O)O |
Computed by PubChem (NCBI)