Products 2377611-05-5
CAS 2377611-05-5 is the registry number for 4-(1-Cyanocyclopropyl)-3-fluorophenylboronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
[4-(1-cyanocyclopropyl)-3-fluorophenyl]boronic acid (CAS 2377611-05-5) is a chemical compound with the molecular formula C10H9BFNO2 and a molecular weight of 205.00 g/mol. IUPAC name: [4-(1-cyanocyclopropyl)-3-fluorophenyl]boronic acid. InChIKey: NUNDSQIXCPDBGF-UHFFFAOYSA-N.
| Molecular formula | C10H9BFNO2 |
|---|---|
| Molecular weight | 205.00 g/mol |
| IUPAC name | [4-(1-cyanocyclopropyl)-3-fluorophenyl]boronic acid |
| InChIKey | NUNDSQIXCPDBGF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C2(CC2)C#N)F)(O)O |
Computed by PubChem (NCBI)