cas: 1008213-43-1 — see every product listed under this CAS number, including other names
3-(1-Cyclohexyl-2,5-dioxoimidazolidin-4-yl)propanoic acid, 97% (CAS 1008213-43-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A368001-5g |
| cas | 1008213-43-1 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 3533.32 Pln | |
| AmBeed | 1g | 1228.78 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-(1-cyclohexyl-2,5-dioxoimidazolidin-4-yl)propanoic acid (CAS 1008213-43-1) is a chemical compound with the molecular formula C12H18N2O4 and a molecular weight of 254.28 g/mol. IUPAC name: 3-(1-cyclohexyl-2,5-dioxoimidazolidin-4-yl)propanoic acid. InChIKey: RFUJQJHOZWCXIN-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O4 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | 3-(1-cyclohexyl-2,5-dioxoimidazolidin-4-yl)propanoic acid |
| InChIKey | RFUJQJHOZWCXIN-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)N2C(=O)C(NC2=O)CCC(=O)O |
Computed by PubChem (NCBI)