cas: 1037160-20-5 — see every product listed under this CAS number, including other names
3-(2,2,2-Trifluoroethoxy)pyridin-2-amine 95+% (CAS 1037160-20-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A880123-100mg |
| cas | 1037160-20-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 587.31 Pln | |
| Ambeed | 250mg | 854.31 Pln | |
| Ambeed | 1g | 1905.62 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A880123 |
3-(2,2,2-trifluoroethoxy)pyridin-2-amine (CAS 1037160-20-5) is a chemical compound with the molecular formula C7H7F3N2O and a molecular weight of 192.14 g/mol. IUPAC name: 3-(2,2,2-trifluoroethoxy)pyridin-2-amine. InChIKey: BSSPNISMQJMZBJ-UHFFFAOYSA-N.
| Molecular formula | C7H7F3N2O |
|---|---|
| Molecular weight | 192.14 g/mol |
| IUPAC name | 3-(2,2,2-trifluoroethoxy)pyridin-2-amine |
| InChIKey | BSSPNISMQJMZBJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)N)OCC(F)(F)F |
Computed by PubChem (NCBI)