CAS 1443279-72-8 is the registry number for 1-Ethyl-3-(trifluoromethyl)pyrazole-4-carbaldehyde, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
1-ethyl-3-(trifluoromethyl)pyrazole-4-carbaldehyde (CAS 1443279-72-8) is a chemical compound with the molecular formula C7H7F3N2O and a molecular weight of 192.14 g/mol. IUPAC name: 1-ethyl-3-(trifluoromethyl)pyrazole-4-carbaldehyde. InChIKey: QODWRUTVZKZAKA-UHFFFAOYSA-N.
| Molecular formula | C7H7F3N2O |
|---|---|
| Molecular weight | 192.14 g/mol |
| IUPAC name | 1-ethyl-3-(trifluoromethyl)pyrazole-4-carbaldehyde |
| InChIKey | QODWRUTVZKZAKA-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(=N1)C(F)(F)F)C=O |
Computed by PubChem (NCBI)