3-(2,6-Dimethoxyphenyl)propanoic acid, 95%
cas: 6683-69-8 — see every product listed under this CAS number, including other names
3-(2,6-Dimethoxyphenyl)propanoic acid, 95% (CAS 6683-69-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1042223-250mg |
| cas | 6683-69-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 665.19 Pln | |
| Ambeed | 1g | 1660.88 Pln | |
| Ambeed | 5g | 4686.88 Pln | |
| BLDpharm | 100mg | 414.32 Pln | |
| BLDpharm | 250mg | 653.13 Pln | |
| BLDpharm | 1g | 1636.12 Pln | |
| BLDpharm | 5g | 4596.18 Pln | |
| Chemat | 100mg | 472.40 Pln | |
| Chemat | 250mg | 765.20 Pln | |
| Chemat | 1g | 1950.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3-(2,6-dimethoxyphenyl)propanoic acid (CAS 6683-69-8) is a chemical compound with the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. IUPAC name: 3-(2,6-dimethoxyphenyl)propanoic acid. InChIKey: VHCJLYGQVWLQHU-UHFFFAOYSA-N.
| Molecular formula | C11H14O4 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 3-(2,6-dimethoxyphenyl)propanoic acid |
| InChIKey | VHCJLYGQVWLQHU-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC=C1)OC)CCC(=O)O |
Computed by PubChem (NCBI)