cas: 850567-31-6 — see every product listed under this CAS number, including other names
3-(2-(Dimethylamino)ethylcarbamoyl)phenylboronic acid, 98%, 98% (CAS 850567-31-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115Z93-250mg |
| cas | 850567-31-6 |
| size | 250mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 491.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[3-[2-(dimethylamino)ethylcarbamoyl]phenyl]boronic acid (CAS 850567-31-6) is a chemical compound with the molecular formula C11H17BN2O3 and a molecular weight of 236.08 g/mol. IUPAC name: [3-[2-(dimethylamino)ethylcarbamoyl]phenyl]boronic acid. InChIKey: WGZQGJKHTBTXLD-UHFFFAOYSA-N.
| Molecular formula | C11H17BN2O3 |
|---|---|
| Molecular weight | 236.08 g/mol |
| IUPAC name | [3-[2-(dimethylamino)ethylcarbamoyl]phenyl]boronic acid |
| InChIKey | WGZQGJKHTBTXLD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)NCCN(C)C)(O)O |
Computed by PubChem (NCBI)