cas: 862254-43-1 — see every product listed under this CAS number, including other names
3-(2-Aminothiazol-4-yl)benzoic acid, 98% (CAS 862254-43-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F446991-250MG |
| cas | 862254-43-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 372.80 Pln | |
| Fluorochem | 1g | 653.95 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
3-(2-amino-1,3-thiazol-4-yl)benzoic acid (CAS 862254-43-1) is a chemical compound with the molecular formula C10H8N2O2S and a molecular weight of 220.25 g/mol. IUPAC name: 3-(2-amino-1,3-thiazol-4-yl)benzoic acid. InChIKey: FUVRHVASGCIPSM-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2S |
|---|---|
| Molecular weight | 220.25 g/mol |
| IUPAC name | 3-(2-amino-1,3-thiazol-4-yl)benzoic acid |
| InChIKey | FUVRHVASGCIPSM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CSC(=N2)N |
Computed by PubChem (NCBI)