CAS 802276-49-9 appears in our catalog under these names: 2-Amino-5-phenyl-4-thiazolecarboxylic acid, 95%, 2-Amino-5-phenyl-1,3-thiazole-4-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 0,5g.
2-amino-5-phenyl-1,3-thiazole-4-carboxylic acid (CAS 802276-49-9) is a chemical compound with the molecular formula C10H8N2O2S and a molecular weight of 220.25 g/mol. IUPAC name: 2-amino-5-phenyl-1,3-thiazole-4-carboxylic acid. InChIKey: VTYHQGNZJJXPBE-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2S |
|---|---|
| Molecular weight | 220.25 g/mol |
| IUPAC name | 2-amino-5-phenyl-1,3-thiazole-4-carboxylic acid |
| InChIKey | VTYHQGNZJJXPBE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=C(S2)N)C(=O)O |
Computed by PubChem (NCBI)