CAS 34418-48-9 appears in our catalog under these names: 4-Methyl-2-pyridin-2-yl-1,3-thiazole-5-carboxylic acid, 97%, 2–(2–pyridyl)–4–methyl–Thiazole–5–Carboxylic Acid, 2-(2-Pyridyl)-4-methylthiazole-5-carboxylic acid, 4-Methyl-2-(Pyridin-2-Yl)Thiazole-5-Carboxylic Acid, 97%, 97%, 2-(2-Pyridyl)-4-methyl-thiazole-5-carboxylic acid, 97.0%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg, Get quote, 10g.
4-methyl-2-pyridin-2-yl-1,3-thiazole-5-carboxylic acid (CAS 34418-48-9) is a chemical compound with the molecular formula C10H8N2O2S and a molecular weight of 220.25 g/mol. IUPAC name: 4-methyl-2-pyridin-2-yl-1,3-thiazole-5-carboxylic acid. InChIKey: QFDHWPOPCNNAOI-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2S |
|---|---|
| Molecular weight | 220.25 g/mol |
| IUPAC name | 4-methyl-2-pyridin-2-yl-1,3-thiazole-5-carboxylic acid |
| InChIKey | QFDHWPOPCNNAOI-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC=CC=N2)C(=O)O |
Computed by PubChem (NCBI)