cas: 1052526-99-4 — see every product listed under this CAS number, including other names
3-(2-Isopropyl-1h-imidazol-1-yl)propanoic acid hydrochloride, 97% (CAS 1052526-99-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1358080-25g |
| cas | 1052526-99-4 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 16351.51 Pln | |
| AmBeed | 1g | 1879.78 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-(2-propan-2-ylimidazol-1-yl)propanoic acid;hydrochloride (CAS 1052526-99-4) is a chemical compound with the molecular formula C9H15ClN2O2 and a molecular weight of 218.68 g/mol. IUPAC name: 3-(2-propan-2-ylimidazol-1-yl)propanoic acid;hydrochloride. InChIKey: IBXROQZOCMEXLE-UHFFFAOYSA-N.
| Molecular formula | C9H15ClN2O2 |
|---|---|
| Molecular weight | 218.68 g/mol |
| IUPAC name | 3-(2-propan-2-ylimidazol-1-yl)propanoic acid;hydrochloride |
| InChIKey | IBXROQZOCMEXLE-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC=CN1CCC(=O)O.Cl |
Computed by PubChem (NCBI)