CAS 205927-63-5 is the registry number for 3-(2-Oxopropyl)benzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-(2-oxopropyl)benzoic acid (CAS 205927-63-5) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 3-(2-oxopropyl)benzoic acid. InChIKey: PUKRMMAKVJOWIF-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 3-(2-oxopropyl)benzoic acid |
| InChIKey | PUKRMMAKVJOWIF-UHFFFAOYSA-N |
| SMILES | CC(=O)CC1=CC(=CC=C1)C(=O)O |
Computed by PubChem (NCBI)