cas: 1229025-67-5 — see every product listed under this CAS number, including other names
3-(3,5-Dimethyl-1H-pyrazol-4-yl)benzoic acid, ≥95%, ≥95% (CAS 1229025-67-5) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12F39G-5g |
| cas | 1229025-67-5 |
| size | 5g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 7370.00 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
3-(3,5-dimethyl-1H-pyrazol-4-yl)benzoic acid (CAS 1229025-67-5) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. IUPAC name: 3-(3,5-dimethyl-1H-pyrazol-4-yl)benzoic acid. InChIKey: JUMMUZIWYCEJRA-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 216.24 g/mol |
| IUPAC name | 3-(3,5-dimethyl-1H-pyrazol-4-yl)benzoic acid |
| InChIKey | JUMMUZIWYCEJRA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)