CAS 61226-19-5 appears in our catalog under these names: 3,5-Dimethyl-1-phenyl-1h-pyrazole-4-carboxylic acid, 95%, 3,5-Dimethyl-1-phenyl-1H-pyrazole-4-carboxylic acid, 98+%, 3,5–Dimethyl–1–phenyl–1H–pyrazole–4–carboxylic acid, 3,5-Dimethyl-1-phenyl-1H-pyrazole-4-carboxylic acid, 97% , 3,5-Dimethyl-1-phenyl-1H-pyrazole-4-carboxylic acid, ≥97%, ≥97%. Offered by: Combi-blocks, AmBeed, GLPBio, Thermo Scientific, Chemat. Available pack sizes: 1g, 10g, 5g, 250mg.
3,5-dimethyl-1-phenylpyrazole-4-carboxylic acid (CAS 61226-19-5) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. IUPAC name: 3,5-dimethyl-1-phenylpyrazole-4-carboxylic acid. InChIKey: LPYTYYLNGJGJGW-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 216.24 g/mol |
| IUPAC name | 3,5-dimethyl-1-phenylpyrazole-4-carboxylic acid |
| InChIKey | LPYTYYLNGJGJGW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2=CC=CC=C2)C)C(=O)O |
Computed by PubChem (NCBI)