CAS 192701-73-8 appears in our catalog under these names: Methyl 3-p-tolyl-1h-pyrazole-5-carboxylate, 96%, Methyl 3–(p–tolyl)–1H–pyrazole–5–carboxylate, Methyl 3-p-tolyl-1H-pyrazole-5-carboxylate. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 5g, 1g, 10g, 2,5g.
Methyl 3-(4-methylphenyl)-1H-pyrazole-5-carboxylate (CAS 192701-73-8) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. IUPAC name: methyl 3-(4-methylphenyl)-1H-pyrazole-5-carboxylate. InChIKey: QQBASWCUEOBWNQ-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 216.24 g/mol |
| IUPAC name | methyl 3-(4-methylphenyl)-1H-pyrazole-5-carboxylate |
| InChIKey | QQBASWCUEOBWNQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NNC(=C2)C(=O)OC |
Computed by PubChem (NCBI)