cas: 42288-04-0 — see every product listed under this CAS number, including other names
3-(3-Bromophenyl)-3-methylbutanoic acid, 96%, 96% (CAS 42288-04-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12BAVD-100mg |
| cas | 42288-04-0 |
| size | 100mg |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 347.60 Pln | |
| Chemat | 250mg | 534.80 Pln | |
| Chemat | 1g | 1053.20 Pln | |
| Chemat | 5g | 2925.20 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
3-(3-bromophenyl)-3-methylbutanoic acid (CAS 42288-04-0) is a chemical compound with the molecular formula C11H13BrO2 and a molecular weight of 257.12 g/mol. IUPAC name: 3-(3-bromophenyl)-3-methylbutanoic acid. InChIKey: VVQTXSQOEZFAHV-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO2 |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | 3-(3-bromophenyl)-3-methylbutanoic acid |
| InChIKey | VVQTXSQOEZFAHV-UHFFFAOYSA-N |
| SMILES | CC(C)(CC(=O)O)C1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)