cas: 31255-57-9 — see every product listed under this CAS number, including other names
3-(3-Chlorophenethyl)picolinonitrile 97% (CAS 31255-57-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A675715-5g |
| cas | 31255-57-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 142.31 Pln | |
| Ambeed | 25g | 303.62 Pln | |
| Ambeed | 100g | 804.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A675715 |
3-[2-(3-chlorophenyl)ethyl]pyridine-2-carbonitrile (CAS 31255-57-9) is a chemical compound with the molecular formula C14H11ClN2 and a molecular weight of 242.70 g/mol. IUPAC name: 3-[2-(3-chlorophenyl)ethyl]pyridine-2-carbonitrile. InChIKey: JPCGKKFEDUHGDF-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2 |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | 3-[2-(3-chlorophenyl)ethyl]pyridine-2-carbonitrile |
| InChIKey | JPCGKKFEDUHGDF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)CCC2=C(N=CC=C2)C#N |
Computed by PubChem (NCBI)