cas: 19725-18-9 — see every product listed under this CAS number, including other names
3-(3-Methoxyphenyl)piperidine hydrochloride, 97%, 97% (CAS 19725-18-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113APA-50mg |
| cas | 19725-18-9 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 294.80 Pln | |
| Chemat | 100mg | 448.40 Pln | |
| Chemat | 250mg | 645.20 Pln | |
| Chemat | 1g | 1403.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-(3-methoxyphenyl)piperidine;hydrochloride (CAS 19725-18-9) is a chemical compound with the molecular formula C12H18ClNO and a molecular weight of 227.73 g/mol. IUPAC name: 3-(3-methoxyphenyl)piperidine;hydrochloride. InChIKey: KTJLKTQSWVXPPM-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNO |
|---|---|
| Molecular weight | 227.73 g/mol |
| IUPAC name | 3-(3-methoxyphenyl)piperidine;hydrochloride |
| InChIKey | KTJLKTQSWVXPPM-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2CCCNC2.Cl |
Computed by PubChem (NCBI)