CAS 5250-02-2 appears in our catalog under these names: 3-(Dimethylamino)-1-(4-methylphenyl)propan-1-one hydrochloride, 95%, 3–(Dimethylamino)–1–(4–methylphenyl)propan–1–one Hydrochloride, 3-(Dimethylamino)-1-(4-methylphenyl)propan-1-one, HCl, >97%, >97%, 3-(DIMETHYLAMINO)-1-(4-METHYLPHENYL)PROPAN-1-ONE HCL. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g.
3-(dimethylamino)-1-(4-methylphenyl)propan-1-one;hydrochloride (CAS 5250-02-2) is a chemical compound with the molecular formula C12H18ClNO and a molecular weight of 227.73 g/mol. IUPAC name: 3-(dimethylamino)-1-(4-methylphenyl)propan-1-one;hydrochloride. InChIKey: SDNGTEVPTBGTKK-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNO |
|---|---|
| Molecular weight | 227.73 g/mol |
| IUPAC name | 3-(dimethylamino)-1-(4-methylphenyl)propan-1-one;hydrochloride |
| InChIKey | SDNGTEVPTBGTKK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)CCN(C)C.Cl |
Computed by PubChem (NCBI)