CAS 105973-51-1 appears in our catalog under these names: 1-Benzyl-3-hydroxypiperidine hydrochloride, 1-Benzyl-3-piperidinol hydrochloride, 95%, 1-Benzyl-3-piperidinol hydrochloride, 97% , 1-Benzylpiperidin-3-ol hydrochloride, 95%, 1-Benzyl-3-piperidinol hydrochloride, 98+%, 98+%. Offered by: Biosynth, Combi-blocks, Thermo Scientific, Fluorochem, Chemat. Available pack sizes: 25g, 50g, 100g, 5g, 1g, 10g, 500g.
1-benzylpiperidin-3-ol;hydrochloride (CAS 105973-51-1) is a chemical compound with the molecular formula C12H18ClNO and a molecular weight of 227.73 g/mol. IUPAC name: 1-benzylpiperidin-3-ol;hydrochloride. InChIKey: PHJDPNCYJSWYGY-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNO |
|---|---|
| Molecular weight | 227.73 g/mol |
| IUPAC name | 1-benzylpiperidin-3-ol;hydrochloride |
| InChIKey | PHJDPNCYJSWYGY-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)CC2=CC=CC=C2)O.Cl |
Computed by PubChem (NCBI)