cas: 1112209-48-9 — see every product listed under this CAS number, including other names
3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethoxy)benzaldehyde 95+% (CAS 1112209-48-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A567111-100mg |
| cas | 1112209-48-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 131.19 Pln | |
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1327.12 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A567111 |
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethoxy)benzaldehyde (CAS 1112209-48-9) is a chemical compound with the molecular formula C14H16BF3O4 and a molecular weight of 316.08 g/mol. IUPAC name: 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethoxy)benzaldehyde. InChIKey: GFHMALKDEOCONV-UHFFFAOYSA-N.
| Molecular formula | C14H16BF3O4 |
|---|---|
| Molecular weight | 316.08 g/mol |
| IUPAC name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethoxy)benzaldehyde |
| InChIKey | GFHMALKDEOCONV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)OC(F)(F)F)C=O |
Computed by PubChem (NCBI)