cas: 380151-86-0 — see every product listed under this CAS number, including other names
3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-benzaldehyde, 97% (CAS 380151-86-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F021628-1G |
| cas | 380151-86-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 5g | 122.89 Pln | |
| Fluorochem | 10g | 143.72 Pln | |
| Fluorochem | 25g | 221.81 Pln | |
| Fluorochem | 100g | 638.33 Pln | |
| Fluorochem | 500g | 2455.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 380151-86-0) is a chemical compound with the molecular formula C13H17BO3 and a molecular weight of 232.09 g/mol. IUPAC name: 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: IFYMOLFMYIDYEN-UHFFFAOYSA-N.
| Molecular formula | C13H17BO3 |
|---|---|
| Molecular weight | 232.09 g/mol |
| IUPAC name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | IFYMOLFMYIDYEN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C=O |
Computed by PubChem (NCBI)