cas: 1239700-57-2 — see every product listed under this CAS number, including other names
3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-en-1-ol 94% (CAS 1239700-57-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A222934-50mg |
| cas | 1239700-57-2 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 331.44 Pln | |
| Ambeed | 100mg | 487.19 Pln |
| purity | 94% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A222934 |
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-en-1-ol (CAS 1239700-57-2) is a chemical compound with the molecular formula C10H19BO3 and a molecular weight of 198.07 g/mol. IUPAC name: 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-en-1-ol. InChIKey: PXYZFYLZNSFEFI-UHFFFAOYSA-N.
| Molecular formula | C10H19BO3 |
|---|---|
| Molecular weight | 198.07 g/mol |
| IUPAC name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-en-1-ol |
| InChIKey | PXYZFYLZNSFEFI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C(=C)CCO |
Computed by PubChem (NCBI)