cas: 302577-72-6 — see every product listed under this CAS number, including other names
3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexanone 95% (CAS 302577-72-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A262426-100mg |
| cas | 302577-72-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 459.38 Pln | |
| Ambeed | 250mg | 787.56 Pln | |
| Ambeed | 1g | 2244.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A262426 |
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexan-1-one (CAS 302577-72-6) is a chemical compound with the molecular formula C12H21BO3 and a molecular weight of 224.11 g/mol. IUPAC name: 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexan-1-one. InChIKey: RDLPCDXZYPJXPO-UHFFFAOYSA-N.
| Molecular formula | C12H21BO3 |
|---|---|
| Molecular weight | 224.11 g/mol |
| IUPAC name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexan-1-one |
| InChIKey | RDLPCDXZYPJXPO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CCCC(=O)C2 |
Computed by PubChem (NCBI)