cas: 302577-72-6 — see every product listed under this CAS number, including other names
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexanone, 96%, 96% (CAS 302577-72-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113ZD9-100mg |
| cas | 302577-72-6 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 290.00 Pln | |
| Chemat | 250mg | 443.60 Pln | |
| Chemat | 500mg | 693.20 Pln | |
| Chemat | 1g | 1005.20 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexan-1-one (CAS 302577-72-6) is a chemical compound with the molecular formula C12H21BO3 and a molecular weight of 224.11 g/mol. IUPAC name: 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexan-1-one. InChIKey: RDLPCDXZYPJXPO-UHFFFAOYSA-N.
| Molecular formula | C12H21BO3 |
|---|---|
| Molecular weight | 224.11 g/mol |
| IUPAC name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexan-1-one |
| InChIKey | RDLPCDXZYPJXPO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CCCC(=O)C2 |
Computed by PubChem (NCBI)