cas: 1187591-40-7 — see every product listed under this CAS number, including other names
3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylic acid 95% (CAS 1187591-40-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1480184-250mg |
| cas | 1187591-40-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 542.81 Pln | |
| Ambeed | 1g | 1277.06 Pln | |
| Ambeed | 5g | 4364.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1480184 |
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylic acid (CAS 1187591-40-7) is a chemical compound with the molecular formula C11H15BO4S and a molecular weight of 254.11 g/mol. IUPAC name: 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylic acid. InChIKey: YYTPBHAOYSFFMW-UHFFFAOYSA-N.
| Molecular formula | C11H15BO4S |
|---|---|
| Molecular weight | 254.11 g/mol |
| IUPAC name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylic acid |
| InChIKey | YYTPBHAOYSFFMW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(SC=C2)C(=O)O |
Computed by PubChem (NCBI)