CAS 1354699-11-8 is the registry number for 4-Carboxythiophene-2-boronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carboxylic acid (CAS 1354699-11-8) is a chemical compound with the molecular formula C11H15BO4S and a molecular weight of 254.11 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carboxylic acid. InChIKey: ODRDHGWKNSDKHM-UHFFFAOYSA-N.
| Molecular formula | C11H15BO4S |
|---|---|
| Molecular weight | 254.11 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carboxylic acid |
| InChIKey | ODRDHGWKNSDKHM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CS2)C(=O)O |
Computed by PubChem (NCBI)