Products 1175560-94-7
CAS 1175560-94-7 appears in our catalog under these names: [4-(Cyclopentanesulfonyl)phenyl]boronic acid, 96%, (4-(Cyclopentanesulfonyl)phenyl)boronic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
(4-cyclopentylsulfonylphenyl)boronic acid (CAS 1175560-94-7) is a chemical compound with the molecular formula C11H15BO4S and a molecular weight of 254.11 g/mol. IUPAC name: (4-cyclopentylsulfonylphenyl)boronic acid. InChIKey: UXPQPYAEXRTCAM-UHFFFAOYSA-N.
| Molecular formula | C11H15BO4S |
|---|---|
| Molecular weight | 254.11 g/mol |
| IUPAC name | (4-cyclopentylsulfonylphenyl)boronic acid |
| InChIKey | UXPQPYAEXRTCAM-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)C2CCCC2)(O)O |
Computed by PubChem (NCBI)