3-(4-(4,4,5,5-Tetramethyl-1,3,2-Dioxaborolan-2-Yl)Phenyl)Piperidine-2,6-Dione, 97%
cas: 3027262-96-7 — see every product listed under this CAS number, including other names
3-(4-(4,4,5,5-Tetramethyl-1,3,2-Dioxaborolan-2-Yl)Phenyl)Piperidine-2,6-Dione, 97% (CAS 3027262-96-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch1F2CAP-50mg |
| cas | 3027262-96-7 |
| size | 50mg |
| availability | 20g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 386.00 Pln | |
| Chemat | 100mg | 597.20 Pln | |
| Chemat | 250mg | 957.20 Pln | |
| Chemat | 1g | 2296.40 Pln | |
| Chemat | 5g | 7888.40 Pln | |
| Fluorochem | 100mg | 773.70 Pln | |
| Fluorochem | 250mg | 1257.91 Pln | |
| Fluorochem | 1g | 3022.91 Pln | |
| Fluorochem | 5g | 10134.99 Pln | |
| Fluorochem | 50mg | 497.76 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine-2,6-dione (CAS 3027262-96-7) is a chemical compound with the molecular formula C17H22BNO4 and a molecular weight of 315.2 g/mol. IUPAC name: 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine-2,6-dione. InChIKey: LCWSNUATGLZPDW-UHFFFAOYSA-N.
| Molecular formula | C17H22BNO4 |
|---|---|
| Molecular weight | 315.2 g/mol |
| IUPAC name | 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine-2,6-dione |
| InChIKey | LCWSNUATGLZPDW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3CCC(=O)NC3=O |
Computed by PubChem (NCBI)