CAS 103489-31-2 appears in our catalog under these names: 3-(4-Azidophenyl)propionic acid, 3–(4–Azidophenyl)propionic acid, N3-Phenylpropionic-OH, 3-(4-Azidophenyl)propionic acid, ≥99%. Offered by: Creative Peptides, GLPBio, Iris Biotech, Sigma-Aldrich, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 500mg, 25g, 100mg.
3-(4-azidophenyl)propanoic acid (CAS 103489-31-2) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: 3-(4-azidophenyl)propanoic acid. InChIKey: RZYXFEOBOVVBLL-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | 3-(4-azidophenyl)propanoic acid |
| InChIKey | RZYXFEOBOVVBLL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCC(=O)O)N=[N+]=[N-] |
Computed by PubChem (NCBI)