CAS 113053-51-3 is the registry number for Methyl 1-methyl-1,2,3-benzotriazole-5-carboxylate, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
Methyl 1-methylbenzotriazole-5-carboxylate (CAS 113053-51-3) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: methyl 1-methylbenzotriazole-5-carboxylate. InChIKey: VFQRXXONGCAZMY-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | methyl 1-methylbenzotriazole-5-carboxylate |
| InChIKey | VFQRXXONGCAZMY-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)C(=O)OC)N=N1 |
Computed by PubChem (NCBI)