CAS 1860028-29-0 appears in our catalog under these names: 5-Methyl-5h-pyrrolo[2,3-b]pyrazine-7-carboxylic acid methyl ester, 95%, Methyl 5-methyl-5H-pyrrolo[2,3-b]pyrazine-7-carboxylate, 97%, 97%, 5-METHYL-5H-PYRROLO[2,3-B]PYRAZINE-7-CARBOXYLIC ACID METHYL ESTER, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 500mg, 5g.
Methyl 5-methylpyrrolo[2,3-b]pyrazine-7-carboxylate (CAS 1860028-29-0) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: methyl 5-methylpyrrolo[2,3-b]pyrazine-7-carboxylate. InChIKey: PVKZVESZAMWASP-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | methyl 5-methylpyrrolo[2,3-b]pyrazine-7-carboxylate |
| InChIKey | PVKZVESZAMWASP-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=NC=CN=C21)C(=O)OC |
Computed by PubChem (NCBI)