cas: 254892-91-6 — see every product listed under this CAS number, including other names
3-(4-Bromophenyl)cyclobutan-1-one, 97%, 97% (CAS 254892-91-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1144GG-100mg |
| cas | 254892-91-6 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 500mg | 246.80 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 1038.80 Pln | |
| Chemat | 10g | 1864.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-(4-bromophenyl)cyclobutan-1-one (CAS 254892-91-6) is a chemical compound with the molecular formula C10H9BrO and a molecular weight of 225.08 g/mol. IUPAC name: 3-(4-bromophenyl)cyclobutan-1-one. InChIKey: FOQRHYVNXUDNKL-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | 3-(4-bromophenyl)cyclobutan-1-one |
| InChIKey | FOQRHYVNXUDNKL-UHFFFAOYSA-N |
| SMILES | C1C(CC1=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)