Products 876-91-5
CAS 876-91-5 appears in our catalog under these names: 4-Bromo-6-methyl-2,3-dihydro-1h-inden-1-one, 95%, 4–Bromo–6–methyl–2，3–dihydro–1H–inden–1–one, 4-Bromo-6-methyl-2,3-dihydro-1H-inden-1-one, 4-Bromo-6-methyl-2,3-dihydro-1H-inden-1-one 98%, 4-Bromo-6-methyl-2,3-dihydro-1H-inden-1-one, 99%, 99%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
4-bromo-6-methyl-2,3-dihydroinden-1-one (CAS 876-91-5) is a chemical compound with the molecular formula C10H9BrO and a molecular weight of 225.08 g/mol. IUPAC name: 4-bromo-6-methyl-2,3-dihydroinden-1-one. InChIKey: GEKKSKKTHXHXLU-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | 4-bromo-6-methyl-2,3-dihydroinden-1-one |
| InChIKey | GEKKSKKTHXHXLU-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(CCC2=O)C(=C1)Br |
Computed by PubChem (NCBI)