CAS 132095-54-6 appears in our catalog under these names: 7-Bromo-2-tetralone, 95%, 7–Bromo–2–tetralone, 7-Bromo-3,4-dihydro-1H-naphthalen-2-one, 98%, 98%, 7-Bromo-2-tetralone, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 250mg, 1g, 100mg, 10g, 25g.
7-bromo-3,4-dihydro-1H-naphthalen-2-one (CAS 132095-54-6) is a chemical compound with the molecular formula C10H9BrO and a molecular weight of 225.08 g/mol. IUPAC name: 7-bromo-3,4-dihydro-1H-naphthalen-2-one. InChIKey: NCTYMQMYDHAKCE-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | 7-bromo-3,4-dihydro-1H-naphthalen-2-one |
| InChIKey | NCTYMQMYDHAKCE-UHFFFAOYSA-N |
| SMILES | C1CC2=C(CC1=O)C=C(C=C2)Br |
Computed by PubChem (NCBI)