cas: 682760-24-3 — see every product listed under this CAS number, including other names
3-(4-Fluoro-benzenesulfonyl)-propionic acid (CAS 682760-24-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F485493-250MG |
| cas | 682760-24-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 810.15 Pln |
| delivery time | 2-3 weeks |
|---|
3-(4-fluorophenyl)sulfonylpropanoic acid (CAS 682760-24-3) is a chemical compound with the molecular formula C9H9FO4S and a molecular weight of 232.23 g/mol. IUPAC name: 3-(4-fluorophenyl)sulfonylpropanoic acid. InChIKey: AUOJGJQMJQUYSP-UHFFFAOYSA-N.
| Molecular formula | C9H9FO4S |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | 3-(4-fluorophenyl)sulfonylpropanoic acid |
| InChIKey | AUOJGJQMJQUYSP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1F)S(=O)(=O)CCC(=O)O |
Computed by PubChem (NCBI)