Products 21864-49-3

CAS 21864-49-3 is the registry number for 3-[4-(Fluorosulfonyl)phenyl]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

3-(4-fluorosulfonylphenyl)propanoic acid (CAS 21864-49-3) is a chemical compound with the molecular formula C9H9FO4S and a molecular weight of 232.23 g/mol. IUPAC name: 3-(4-fluorosulfonylphenyl)propanoic acid. InChIKey: YRHOCAXPYRDPPX-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9FO4S
Molecular weight232.23 g/mol
IUPAC name3-(4-fluorosulfonylphenyl)propanoic acid
InChIKeyYRHOCAXPYRDPPX-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1CCC(=O)O)S(=O)(=O)F

Computed by PubChem (NCBI)