Products 118939-18-7

CAS 118939-18-7 is the registry number for 3-Fluoro-2-methyl-4-(methylsulfonyl)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

3-fluoro-2-methyl-4-methylsulfonylbenzoic acid (CAS 118939-18-7) is a chemical compound with the molecular formula C9H9FO4S and a molecular weight of 232.23 g/mol. IUPAC name: 3-fluoro-2-methyl-4-methylsulfonylbenzoic acid. InChIKey: AMTWIUHPASHZQO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9FO4S
Molecular weight232.23 g/mol
IUPAC name3-fluoro-2-methyl-4-methylsulfonylbenzoic acid
InChIKeyAMTWIUHPASHZQO-UHFFFAOYSA-N
SMILESCC1=C(C=CC(=C1F)S(=O)(=O)C)C(=O)O

Computed by PubChem (NCBI)