cas: 147404-69-1 — see every product listed under this CAS number, including other names
3-(4-Methylphenyl)benzoic acid (CAS 147404-69-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F014237-250MG |
| cas | 147404-69-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 1g | 247.85 Pln | |
| Fluorochem | 5g | 862.21 Pln |
| delivery time | 2-3 weeks |
|---|
3-(4-methylphenyl)benzoic acid (CAS 147404-69-1) is a chemical compound with the molecular formula C14H12O2 and a molecular weight of 212.24 g/mol. IUPAC name: 3-(4-methylphenyl)benzoic acid. InChIKey: APYJGQZXCGXMGB-UHFFFAOYSA-N.
| Molecular formula | C14H12O2 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | 3-(4-methylphenyl)benzoic acid |
| InChIKey | APYJGQZXCGXMGB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)