cas: 220080-93-3 — see every product listed under this CAS number, including other names
3-(5,5-Dimethyl-1,3,2-dioxaborinan-2-yl)aniline, 95%(GC-MS),RG, 95%(GC-MS),RG (CAS 220080-93-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I5AL-250mg |
| cas | 220080-93-3 |
| size | 250mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 861.20 Pln | |
| Chemat | 25g | 3429.20 Pln |
| purity | 95%(GC-MS),RG |
|---|---|
| delivery time | 3 weeks |
3-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)aniline (CAS 220080-93-3) is a chemical compound with the molecular formula C11H16BNO2 and a molecular weight of 205.06 g/mol. IUPAC name: 3-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)aniline. InChIKey: CIZWNGWYNHXPFJ-UHFFFAOYSA-N.
| Molecular formula | C11H16BNO2 |
|---|---|
| Molecular weight | 205.06 g/mol |
| IUPAC name | 3-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)aniline |
| InChIKey | CIZWNGWYNHXPFJ-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC(=CC=C2)N |
Computed by PubChem (NCBI)