cas: 220080-93-3 — see every product listed under this CAS number, including other names
3-(5,5-Dimethyl-1,3,2-dioxaborinan-2-yl)aniline (CAS 220080-93-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F692036-250MG |
| cas | 220080-93-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 195.78 Pln | |
| Fluorochem | 1g | 419.66 Pln | |
| Fluorochem | 5g | 1403.69 Pln | |
| Fluorochem | 25g | 5652.19 Pln |
| delivery time | 3-4 weeks |
|---|
3-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)aniline (CAS 220080-93-3) is a chemical compound with the molecular formula C11H16BNO2 and a molecular weight of 205.06 g/mol. IUPAC name: 3-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)aniline. InChIKey: CIZWNGWYNHXPFJ-UHFFFAOYSA-N.
| Molecular formula | C11H16BNO2 |
|---|---|
| Molecular weight | 205.06 g/mol |
| IUPAC name | 3-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)aniline |
| InChIKey | CIZWNGWYNHXPFJ-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC(=CC=C2)N |
Computed by PubChem (NCBI)