CAS 1036991-20-4 appears in our catalog under these names: 4-(1-Pyrrolidinylmethyl)phenylboronic acid, 95%, (4–(pyrrolidin–1–ylmethyl)phenyl)boronic acid, 4-(PYRROLIDIN-1-YLMETHYL)PHENYLBORONIC ACID, 95%, 4-(Pyrrolidin-1-ylmethyl)phenylboronic acid, 95-<97%, 4-(Pyrrolidin-1-ylmethyl)phenylboronic acid, ≥97-<99%. Offered by: Combi-blocks, GLPBio, Fluorochem, Hoffman Fine Chemicals, AmBeed. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g.
[4-(pyrrolidin-1-ylmethyl)phenyl]boronic acid (CAS 1036991-20-4) is a chemical compound with the molecular formula C11H16BNO2 and a molecular weight of 205.06 g/mol. IUPAC name: [4-(pyrrolidin-1-ylmethyl)phenyl]boronic acid. InChIKey: VXHLRYOCYRFLMS-UHFFFAOYSA-N.
| Molecular formula | C11H16BNO2 |
|---|---|
| Molecular weight | 205.06 g/mol |
| IUPAC name | [4-(pyrrolidin-1-ylmethyl)phenyl]boronic acid |
| InChIKey | VXHLRYOCYRFLMS-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CN2CCCC2)(O)O |
Computed by PubChem (NCBI)