cas: 2874277-55-9 — see every product listed under this CAS number, including other names
3-(5-Bromo-1-oxoisoindolin-2-yl)-1-methylpiperidine-2,6-dione 98% (CAS 2874277-55-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A2443942-100mg |
| cas | 2874277-55-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 431.56 Pln | |
| Ambeed | 250mg | 704.12 Pln | |
| Ambeed | 1g | 1761.00 Pln | |
| Ambeed | 5g | 6411.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A2443942 |
3-(6-bromo-3-oxo-1H-isoindol-2-yl)-1-methylpiperidine-2,6-dione (CAS 2874277-55-9) is a chemical compound with the molecular formula C14H13BrN2O3 and a molecular weight of 337.17 g/mol. IUPAC name: 3-(6-bromo-3-oxo-1H-isoindol-2-yl)-1-methylpiperidine-2,6-dione. InChIKey: GGSHPCRODIUWEK-UHFFFAOYSA-N.
| Molecular formula | C14H13BrN2O3 |
|---|---|
| Molecular weight | 337.17 g/mol |
| IUPAC name | 3-(6-bromo-3-oxo-1H-isoindol-2-yl)-1-methylpiperidine-2,6-dione |
| InChIKey | GGSHPCRODIUWEK-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CCC(C1=O)N2CC3=C(C2=O)C=CC(=C3)Br |
Computed by PubChem (NCBI)