CAS 1215205-09-6 is the registry number for N-4-Methoxybenzyl 2-bromo-6-nitroaniline, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-bromo-N-[(4-methoxyphenyl)methyl]-6-nitroaniline (CAS 1215205-09-6) is a chemical compound with the molecular formula C14H13BrN2O3 and a molecular weight of 337.17 g/mol. IUPAC name: 2-bromo-N-[(4-methoxyphenyl)methyl]-6-nitroaniline. InChIKey: ZJLHKMSBGUXUOU-UHFFFAOYSA-N.
| Molecular formula | C14H13BrN2O3 |
|---|---|
| Molecular weight | 337.17 g/mol |
| IUPAC name | 2-bromo-N-[(4-methoxyphenyl)methyl]-6-nitroaniline |
| InChIKey | ZJLHKMSBGUXUOU-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CNC2=C(C=CC=C2Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)