CAS 1150271-16-1 is the registry number for N-(4-methoxybenzyl) 2-bromo-4-nitroaniline, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
2-bromo-N-[(4-methoxyphenyl)methyl]-4-nitroaniline (CAS 1150271-16-1) is a chemical compound with the molecular formula C14H13BrN2O3 and a molecular weight of 337.17 g/mol. IUPAC name: 2-bromo-N-[(4-methoxyphenyl)methyl]-4-nitroaniline. InChIKey: BMWOBECNFSIFRM-UHFFFAOYSA-N.
| Molecular formula | C14H13BrN2O3 |
|---|---|
| Molecular weight | 337.17 g/mol |
| IUPAC name | 2-bromo-N-[(4-methoxyphenyl)methyl]-4-nitroaniline |
| InChIKey | BMWOBECNFSIFRM-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CNC2=C(C=C(C=C2)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)