cas: 96363-26-7 — see every product listed under this CAS number, including other names
3-(Boc-amino)-3-(4-methoxyphenyl)-1-propanol, >97%, >97% (CAS 96363-26-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114I7N-1g |
| cas | 96363-26-7 |
| size | 1g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 630.80 Pln | |
| Chemat | 5g | 1749.20 Pln | |
| Chemat | 25g | 5118.80 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[3-hydroxy-1-(4-methoxyphenyl)propyl]carbamate (CAS 96363-26-7) is a chemical compound with the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. IUPAC name: tert-butyl N-[3-hydroxy-1-(4-methoxyphenyl)propyl]carbamate. InChIKey: KIILCIAJJCYALF-UHFFFAOYSA-N.
| Molecular formula | C15H23NO4 |
|---|---|
| Molecular weight | 281.35 g/mol |
| IUPAC name | tert-butyl N-[3-hydroxy-1-(4-methoxyphenyl)propyl]carbamate |
| InChIKey | KIILCIAJJCYALF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CCO)C1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)