Products 58882-17-0
CAS 58882-17-0 appears in our catalog under these names: 4-[Bis(2-hydroxypropyl)amino]benzoic acid, ethyl ester, 95%, 4-(Bis(2-hydroxypropyl)amino)benzoic acid ethyl ester, 90%, Roxadimate. Offered by: Combi-blocks, Biosynth, MedChemExpress. Available pack sizes: 100mg, 250mg, 10mg, 25mg, 50mg, Get quote.
Ethyl 4-[bis(2-hydroxypropyl)amino]benzoate (CAS 58882-17-0) is a chemical compound with the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. IUPAC name: ethyl 4-[bis(2-hydroxypropyl)amino]benzoate. InChIKey: CBZHHQOZZQEZNJ-UHFFFAOYSA-N.
| Molecular formula | C15H23NO4 |
|---|---|
| Molecular weight | 281.35 g/mol |
| IUPAC name | ethyl 4-[bis(2-hydroxypropyl)amino]benzoate |
| InChIKey | CBZHHQOZZQEZNJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)N(CC(C)O)CC(C)O |
Computed by PubChem (NCBI)